C26H25F2N7O2 — CID 69463423
N-(2,3-difluorophenyl)-2-[3-[[7-[4-[ethynyl(methyl)amino]butoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide (PubChem CID 69463423) has the molecular formula C26H25F2N7O2 and a molecular weight of 505.53 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-[3-[[7-[4-[ethynyl(methyl)amino]butoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide.
| Compound Name | N-(2,3-difluorophenyl)-2-[3-[[7-[4-[ethynyl(methyl)amino]butoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 69463423 |
| Molecular Formula | C26H25F2N7O2 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-[3-[[7-[4-[ethynyl(methyl)amino]butoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
| SMILES | C#CN(C)CCCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4F)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C26H25F2N7O2/c1-3-35(2)11-4-5-12-37-18-9-10-19-22(15-18)29-16-30-26(19)32-23-13-17(33-34-23)14-24(36)31-21-8-6-7-20(27)25(21)28/h1,6-10,13,15-16H,4-5,11-12,14H2,2H3,(H,31,36)(H2,29,30,32,33,34) |
| InChIKey | GNYZWXAJPUJYSU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|