C26H30FN7O3 — CID 68662297
N-(3-fluorophenyl)-2-[3-[[7-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide (PubChem CID 68662297) has the molecular formula C26H30FN7O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-[[7-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[3-[[7-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 68662297 |
| Molecular Formula | C26H30FN7O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-[[7-[3-[(1-hydroxy-2-methylpropan-2-yl)amino]propoxy]quinazolin-4-yl]amino]-1H-pyrazol-5-yl]acetamide |
| SMILES | CC(C)(CO)NCCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C26H30FN7O3/c1-26(2,15-35)30-9-4-10-37-20-7-8-21-22(14-20)28-16-29-25(21)32-23-12-19(33-34-23)13-24(36)31-18-6-3-5-17(27)11-18/h3,5-8,11-12,14,16,30,35H,4,9-10,13,15H2,1-2H3,(H,31,36)(H2,28,29,32,33,34) |
| InChIKey | CGNUXJJGUCAICL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 137.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|