C27H33FN7O6P — CID 10371396
[3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate (PubChem CID 10371396) has the molecular formula C27H33FN7O6P and a molecular weight of 601.58 g/mol. Its IUPAC name is [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate.
| Compound Name | [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10371396 |
| Molecular Formula | C27H33FN7O6P |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [3-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropylamino]-3-methylbutyl] dihydrogen phosphate |
| SMILES | CC(C)(CCOP(=O)(O)O)NCCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1 |
| InChI | InChI=1S/C27H33FN7O6P/c1-27(2,9-12-41-42(37,38)39)31-10-4-11-40-21-7-8-22-23(16-21)29-17-30-26(22)33-24-14-20(34-35-24)15-25(36)32-19-6-3-5-18(28)13-19/h3,5-8,13-14,16-17,31H,4,9-12,15H2,1-2H3,(H,32,36)(H2,37,38,39)(H2,29,30,33,34,35) |
| InChIKey | LFUDYUAKBJGUBN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 183.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|