C28H35FN7O5P — CID 59011198
2-[ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dimethyl phosphite (PubChem CID 59011198) has the molecular formula C28H35FN7O5P and a molecular weight of 599.60 g/mol. Its IUPAC name is 2-[ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dimethyl phosphite.
| Compound Name | 2-[ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dimethyl phosphite |
|---|---|
| PubChem CID | 59011198 |
| Molecular Formula | C28H35FN7O5P |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 2-[ethyl-[3-[4-[[5-[2-(3-fluoroanilino)-2-oxoethyl]-1H-pyrazol-3-yl]amino]quinazolin-7-yl]oxypropyl]amino]ethyl dimethyl phosphite |
| SMILES | CCN(CCCOc1ccc2c(Nc3cc(CC(=O)Nc4cccc(F)c4)[nH]n3)ncnc2c1)CCOP(OC)OC |
| InChI | InChI=1S/C28H35FN7O5P/c1-4-36(12-14-41-42(38-2)39-3)11-6-13-40-23-9-10-24-25(18-23)30-19-31-28(24)33-26-16-22(34-35-26)17-27(37)32-21-8-5-7-20(29)15-21/h5,7-10,15-16,18-19H,4,6,11-14,17H2,1-3H3,(H,32,37)(H2,30,31,33,34,35) |
| InChIKey | ZKPZXYCRFQUGIK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|