C27H32FN7O3 — CID 69289359
N-(3-fluorophenyl)-2-[3-[[7-[3-[2-hydroxyethyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 69289359) has the molecular formula C27H32FN7O3 and a molecular weight of 521.60 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-[[7-[3-[2-hydroxyethyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[3-[[7-[3-[2-hydroxyethyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 69289359 |
| Molecular Formula | C27H32FN7O3 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-[[7-[3-[2-hydroxyethyl(propyl)amino]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | CCCN(CCO)CCCOc1ccc2c(Nc3ccn(CC(=O)Nc4cccc(F)c4)n3)ncnc2c1 |
| InChI | InChI=1S/C27H32FN7O3/c1-2-10-34(13-14-36)11-4-15-38-22-7-8-23-24(17-22)29-19-30-27(23)32-25-9-12-35(33-25)18-26(37)31-21-6-3-5-20(28)16-21/h3,5-9,12,16-17,19,36H,2,4,10-11,13-15,18H2,1H3,(H,31,37)(H,29,30,32,33) |
| InChIKey | DOTBKKPPYBROKP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|