C25H24ClFN6O5 — CID 69290977
[4-[[7-(3-chloropropoxy)quinazolin-4-yl]amino]-1-[2-(3-fluoroanilino)-2-oxoethyl]pyrazol-3-yl] ethyl carbonate (PubChem CID 69290977) has the molecular formula C25H24ClFN6O5 and a molecular weight of 542.96 g/mol. Its IUPAC name is [4-[[7-(3-chloropropoxy)quinazolin-4-yl]amino]-1-[2-(3-fluoroanilino)-2-oxoethyl]pyrazol-3-yl] ethyl carbonate.
| Compound Name | [4-[[7-(3-chloropropoxy)quinazolin-4-yl]amino]-1-[2-(3-fluoroanilino)-2-oxoethyl]pyrazol-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 69290977 |
| Molecular Formula | C25H24ClFN6O5 |
| Molecular Weight | 542.96 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | [4-[[7-(3-chloropropoxy)quinazolin-4-yl]amino]-1-[2-(3-fluoroanilino)-2-oxoethyl]pyrazol-3-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1nn(CC(=O)Nc2cccc(F)c2)cc1Nc1ncnc2cc(OCCCCl)ccc12 |
| InChI | InChI=1S/C25H24ClFN6O5/c1-2-36-25(35)38-24-21(13-33(32-24)14-22(34)30-17-6-3-5-16(27)11-17)31-23-19-8-7-18(37-10-4-9-26)12-20(19)28-15-29-23/h3,5-8,11-13,15H,2,4,9-10,14H2,1H3,(H,30,34)(H,28,29,31) |
| InChIKey | YEHFHEYGHMCSKX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|