C28H33FN8O3 — CID 67261545
N-(3-fluorophenyl)-2-[4-[[7-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 67261545) has the molecular formula C28H33FN8O3 and a molecular weight of 548.62 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[[7-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[[7-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 67261545 |
| Molecular Formula | C28H33FN8O3 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[[7-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(Nc2ncnc3cc(OCCCN4CCN(CCO)CC4)ccc23)cn1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C28H33FN8O3/c29-21-3-1-4-22(15-21)33-27(39)19-37-18-23(17-32-37)34-28-25-6-5-24(16-26(25)30-20-31-28)40-14-2-7-35-8-10-36(11-9-35)12-13-38/h1,3-6,15-18,20,38H,2,7-14,19H2,(H,33,39)(H,30,31,34) |
| InChIKey | ZRKVDUKRIIFYJH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|