C27H30FN7O3 — CID 11785694
2-[4-[[7-[3-(cyclopropylmethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 11785694) has the molecular formula C27H30FN7O3 and a molecular weight of 519.58 g/mol. Its IUPAC name is 2-[4-[[7-[3-(cyclopropylmethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[4-[[7-[3-(cyclopropylmethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 11785694 |
| Molecular Formula | C27H30FN7O3 |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 2-[4-[[7-[3-(cyclopropylmethylamino)propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Nc3cnn(CC(=O)Nc4cccc(F)c4)c3)ncnc2cc1OCCCNCC1CC1 |
| InChI | InChI=1S/C27H30FN7O3/c1-37-24-11-22-23(12-25(24)38-9-3-8-29-13-18-6-7-18)30-17-31-27(22)34-21-14-32-35(15-21)16-26(36)33-20-5-2-4-19(28)10-20/h2,4-5,10-12,14-15,17-18,29H,3,6-9,13,16H2,1H3,(H,33,36)(H,30,31,34) |
| InChIKey | MQUAARDPYYBPKL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|