C25H27F2N7O4 — CID 91592583
N-(2,3-difluorophenyl)-2-[4-[[7-[3-(1,2-dihydroxypropylamino)propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 91592583) has the molecular formula C25H27F2N7O4 and a molecular weight of 527.53 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-[4-[[7-[3-(1,2-dihydroxypropylamino)propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(2,3-difluorophenyl)-2-[4-[[7-[3-(1,2-dihydroxypropylamino)propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 91592583 |
| Molecular Formula | C25H27F2N7O4 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-[4-[[7-[3-(1,2-dihydroxypropylamino)propoxy]quinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | CC(O)C(O)NCCCOc1ccc2c(Nc3cnn(CC(=O)Nc4cccc(F)c4F)c3)ncnc2c1 |
| InChI | InChI=1S/C25H27F2N7O4/c1-15(35)25(37)28-8-3-9-38-17-6-7-18-21(10-17)29-14-30-24(18)32-16-11-31-34(12-16)13-22(36)33-20-5-2-4-19(26)23(20)27/h2,4-7,10-12,14-15,25,28,35,37H,3,8-9,13H2,1H3,(H,33,36)(H,29,30,32) |
| InChIKey | UVCNBTKTSHMDHX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 146.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|