C28H29F2N7O4 — CID 87328681
N-(2,3-difluorophenyl)-2-[4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide (PubChem CID 87328681) has the molecular formula C28H29F2N7O4 and a molecular weight of 565.58 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-[4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide.
| Compound Name | N-(2,3-difluorophenyl)-2-[4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 87328681 |
| Molecular Formula | C28H29F2N7O4 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-[4-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]pyrazol-1-yl]acetamide |
| SMILES | C#CCN(CCO)CCCOc1cc2ncnc(Nc3cnn(CC(=O)Nc4cccc(F)c4F)c3)c2cc1OC |
| InChI | InChI=1S/C28H29F2N7O4/c1-3-8-36(10-11-38)9-5-12-41-25-14-23-20(13-24(25)40-2)28(32-18-31-23)34-19-15-33-37(16-19)17-26(39)35-22-7-4-6-21(29)27(22)30/h1,4,6-7,13-16,18,38H,5,8-12,17H2,2H3,(H,35,39)(H,31,32,34) |
| InChIKey | RRRGAVWGZXDFHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|