C29H30N6O4 — CID 154455968
N-[5-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide (PubChem CID 154455968) has the molecular formula C29H30N6O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is N-[5-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 154455968 |
| Molecular Formula | C29H30N6O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | N-[5-[[7-[3-[2-hydroxyethyl(prop-2-ynyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
| SMILES | C#CCN(CCO)CCCOc1cc2ncnc(Nc3ccc(NC(=O)c4ccccc4)nc3)c2cc1OC |
| InChI | InChI=1S/C29H30N6O4/c1-3-12-35(14-15-36)13-7-16-39-26-18-24-23(17-25(26)38-2)28(32-20-31-24)33-22-10-11-27(30-19-22)34-29(37)21-8-5-4-6-9-21/h1,4-6,8-11,17-20,36H,7,12-16H2,2H3,(H,30,34,37)(H,31,32,33) |
| InChIKey | AETQPTOCCCSNSM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|