C30H31ClN6O3 — CID 69308879
3-chloro-N-[5-[[7-[3-[ethynyl(2-methylpropyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide (PubChem CID 69308879) has the molecular formula C30H31ClN6O3 and a molecular weight of 559.07 g/mol. Its IUPAC name is 3-chloro-N-[5-[[7-[3-[ethynyl(2-methylpropyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide.
| Compound Name | 3-chloro-N-[5-[[7-[3-[ethynyl(2-methylpropyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 69308879 |
| Molecular Formula | C30H31ClN6O3 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 3-chloro-N-[5-[[7-[3-[ethynyl(2-methylpropyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-pyridinyl]benzamide |
| SMILES | C#CN(CCCOc1cc2ncnc(Nc3ccc(NC(=O)c4cccc(Cl)c4)nc3)c2cc1OC)CC(C)C |
| InChI | InChI=1S/C30H31ClN6O3/c1-5-37(18-20(2)3)12-7-13-40-27-16-25-24(15-26(27)39-4)29(34-19-33-25)35-23-10-11-28(32-17-23)36-30(38)21-8-6-9-22(31)14-21/h1,6,8-11,14-17,19-20H,7,12-13,18H2,2-4H3,(H,32,36,38)(H,33,34,35) |
| InChIKey | LHNYZKNQKFGRSD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|