C23H19ClN6O4 — CID 87871106
3-chloro-N-[5-[[6-methoxy-7-[[(2S)-oxiran-2-yl]methoxy]quinazolin-4-yl]amino]pyrimidin-2-yl]benzamide (PubChem CID 87871106) has the molecular formula C23H19ClN6O4 and a molecular weight of 478.90 g/mol. Its IUPAC name is 3-chloro-N-[5-[[6-methoxy-7-[[(2S)-oxiran-2-yl]methoxy]quinazolin-4-yl]amino]pyrimidin-2-yl]benzamide.
| Compound Name | 3-chloro-N-[5-[[6-methoxy-7-[[(2S)-oxiran-2-yl]methoxy]quinazolin-4-yl]amino]pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 87871106 |
| Molecular Formula | C23H19ClN6O4 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-chloro-N-[5-[[6-methoxy-7-[[(2S)-oxiran-2-yl]methoxy]quinazolin-4-yl]amino]pyrimidin-2-yl]benzamide |
| SMILES | COc1cc2c(Nc3cnc(NC(=O)c4cccc(Cl)c4)nc3)ncnc2cc1OC[C@@H]1CO1 |
| InChI | InChI=1S/C23H19ClN6O4/c1-32-19-6-17-18(7-20(19)34-11-16-10-33-16)27-12-28-21(17)29-15-8-25-23(26-9-15)30-22(31)13-3-2-4-14(24)5-13/h2-9,12,16H,10-11H2,1H3,(H,27,28,29)(H,25,26,30,31)/t16-/m0/s1 |
| InChIKey | QKJHKDBRKRWEBQ-INIZCTEOSA-N |
| XLogP | 3.86 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|