C30H36ClN6O7P — CID 10439321
2-[5-[4-[[6-[(3-chlorobenzoyl)amino]-3-pyridinyl]amino]-6-methoxyquinazolin-7-yl]oxypentyl-ethylamino]ethyl dihydrogen phosphate (PubChem CID 10439321) has the molecular formula C30H36ClN6O7P and a molecular weight of 659.08 g/mol. Its IUPAC name is 2-[5-[4-[[6-[(3-chlorobenzoyl)amino]-3-pyridinyl]amino]-6-methoxyquinazolin-7-yl]oxypentyl-ethylamino]ethyl dihydrogen phosphate.
| Compound Name | 2-[5-[4-[[6-[(3-chlorobenzoyl)amino]-3-pyridinyl]amino]-6-methoxyquinazolin-7-yl]oxypentyl-ethylamino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10439321 |
| Molecular Formula | C30H36ClN6O7P |
| Molecular Weight | 659.08 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | 2-[5-[4-[[6-[(3-chlorobenzoyl)amino]-3-pyridinyl]amino]-6-methoxyquinazolin-7-yl]oxypentyl-ethylamino]ethyl dihydrogen phosphate |
| SMILES | CCN(CCCCCOc1cc2ncnc(Nc3ccc(NC(=O)c4cccc(Cl)c4)nc3)c2cc1OC)CCOP(=O)(O)O |
| InChI | InChI=1S/C30H36ClN6O7P/c1-3-37(13-15-44-45(39,40)41)12-5-4-6-14-43-27-18-25-24(17-26(27)42-2)29(34-20-33-25)35-23-10-11-28(32-19-23)36-30(38)21-8-7-9-22(31)16-21/h7-11,16-20H,3-6,12-15H2,1-2H3,(H,32,36,38)(H,33,34,35)(H2,39,40,41) |
| InChIKey | CDKFGNWWZWJVJX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 168.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.08 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|