C23H29N5O3 — CID 129010594
N-[4-[[6-[2-(diethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]acetamide (PubChem CID 129010594) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[4-[[6-[2-(diethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-[2-(diethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 129010594 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-[4-[[6-[2-(diethylamino)ethoxy]-7-methoxyquinazolin-4-yl]amino]phenyl]acetamide |
| SMILES | CCN(CC)CCOc1cc2c(Nc3ccc(NC(C)=O)cc3)ncnc2cc1OC |
| InChI | InChI=1S/C23H29N5O3/c1-5-28(6-2)11-12-31-22-13-19-20(14-21(22)30-4)24-15-25-23(19)27-18-9-7-17(8-10-18)26-16(3)29/h7-10,13-15H,5-6,11-12H2,1-4H3,(H,26,29)(H,24,25,27) |
| InChIKey | LWDSDGZSQXRZJV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |