C21H24N4O4 — CID 171419898
tert-butyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate (PubChem CID 171419898) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is tert-butyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 171419898 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tert-butyl N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]carbamate |
| SMILES | COc1cc2ncnc(Nc3ccc(NC(=O)OC(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C21H24N4O4/c1-21(2,3)29-20(26)25-14-8-6-13(7-9-14)24-19-15-10-17(27-4)18(28-5)11-16(15)22-12-23-19/h6-12H,1-5H3,(H,25,26)(H,22,23,24) |
| InChIKey | NUGGCYYJHUNRQY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |