C19H20N4O3 — CID 90667704
N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenyl]acetamide (PubChem CID 90667704) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenyl]acetamide.
| Compound Name | N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 90667704 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-2-methylphenyl]acetamide |
| SMILES | COc1cc2ncnc(Nc3ccc(NC(C)=O)c(C)c3)c2cc1OC |
| InChI | InChI=1S/C19H20N4O3/c1-11-7-13(5-6-15(11)22-12(2)24)23-19-14-8-17(25-3)18(26-4)9-16(14)20-10-21-19/h5-10H,1-4H3,(H,22,24)(H,20,21,23) |
| InChIKey | WHVPFYPTUQJKGH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |