C23H25N3O4 — CID 170967416
1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-methylphenyl]-3,3-dimethylbutane-1,2-dione (PubChem CID 170967416) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-methylphenyl]-3,3-dimethylbutane-1,2-dione.
| Compound Name | 1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-methylphenyl]-3,3-dimethylbutane-1,2-dione |
|---|---|
| PubChem CID | 170967416 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]-3-methylphenyl]-3,3-dimethylbutane-1,2-dione |
| SMILES | COc1cc2ncnc(Nc3ccc(C(=O)C(=O)C(C)(C)C)cc3C)c2cc1OC |
| InChI | InChI=1S/C23H25N3O4/c1-13-9-14(20(27)21(28)23(2,3)4)7-8-16(13)26-22-15-10-18(29-5)19(30-6)11-17(15)24-12-25-22/h7-12H,1-6H3,(H,24,25,26) |
| InChIKey | KEUMMMAXAFXHBT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|