C19H22N4O3Se — CID 86698279
5-tert-butyl-3-[(6,7-dimethoxyquinazolin-4-yl)amino]selenophene-2-carboxamide (PubChem CID 86698279) has the molecular formula C19H22N4O3Se and a molecular weight of 433.37 g/mol. Its IUPAC name is 5-tert-butyl-3-[(6,7-dimethoxyquinazolin-4-yl)amino]selenophene-2-carboxamide.
| Compound Name | 5-tert-butyl-3-[(6,7-dimethoxyquinazolin-4-yl)amino]selenophene-2-carboxamide |
|---|---|
| PubChem CID | 86698279 |
| Molecular Formula | C19H22N4O3Se |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 5-tert-butyl-3-[(6,7-dimethoxyquinazolin-4-yl)amino]selenophene-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3cc(C(C)(C)C)[se]c3C(N)=O)c2cc1OC |
| InChI | InChI=1S/C19H22N4O3Se/c1-19(2,3)15-8-12(16(27-15)17(20)24)23-18-10-6-13(25-4)14(26-5)7-11(10)21-9-22-18/h6-9H,1-5H3,(H2,20,24)(H,21,22,23) |
| InChIKey | WAYMGYFGLVXPEG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|