C24H31N5O5Se — CID 86698283
N-(5-tert-butyl-2-nitroselenophen-3-yl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 86698283) has the molecular formula C24H31N5O5Se and a molecular weight of 548.50 g/mol. Its IUPAC name is N-(5-tert-butyl-2-nitroselenophen-3-yl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-(5-tert-butyl-2-nitroselenophen-3-yl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 86698283 |
| Molecular Formula | C24H31N5O5Se |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | N-(5-tert-butyl-2-nitroselenophen-3-yl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3cc(C(C)(C)C)[se]c3[N+](=O)[O-])c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C24H31N5O5Se/c1-24(2,3)21-14-18(23(35-21)29(30)31)27-22-16-12-20(19(32-4)13-17(16)25-15-26-22)34-9-5-6-28-7-10-33-11-8-28/h12-15H,5-11H2,1-4H3,(H,25,26,27) |
| InChIKey | QNVGEIXTWZATFL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 111.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|