C20H21N3O3 — CID 134271543
(4-anilino-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate (PubChem CID 134271543) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (4-anilino-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-anilino-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134271543 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (4-anilino-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate |
| SMILES | COc1cc2ncnc(Nc3ccccc3)c2cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,3)19(24)26-17-10-14-15(11-16(17)25-4)21-12-22-18(14)23-13-8-6-5-7-9-13/h5-12H,1-4H3,(H,21,22,23) |
| InChIKey | LBJJQNLGXXAHLV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|