C14H15ClN2O3 — CID 122446171
(4-chloro-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate (PubChem CID 122446171) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is (4-chloro-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-chloro-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122446171 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (4-chloro-7-methoxyquinazolin-6-yl) 2,2-dimethylpropanoate |
| SMILES | COc1cc2ncnc(Cl)c2cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H15ClN2O3/c1-14(2,3)13(18)20-11-5-8-9(6-10(11)19-4)16-7-17-12(8)15/h5-7H,1-4H3 |
| InChIKey | UMXJKOXOEXFYTE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|