C16H15ClN2O3 — CID 141337524
(4-chloro-3-cyano-7-methoxyquinolin-6-yl) 2,2-dimethylpropanoate (PubChem CID 141337524) has the molecular formula C16H15ClN2O3 and a molecular weight of 318.76 g/mol. Its IUPAC name is (4-chloro-3-cyano-7-methoxyquinolin-6-yl) 2,2-dimethylpropanoate.
| Compound Name | (4-chloro-3-cyano-7-methoxyquinolin-6-yl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 141337524 |
| Molecular Formula | C16H15ClN2O3 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (4-chloro-3-cyano-7-methoxyquinolin-6-yl) 2,2-dimethylpropanoate |
| SMILES | COc1cc2ncc(C#N)c(Cl)c2cc1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H15ClN2O3/c1-16(2,3)15(20)22-13-5-10-11(6-12(13)21-4)19-8-9(7-18)14(10)17/h5-6,8H,1-4H3 |
| InChIKey | GDEQTQMERPNRBX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|