C13H12ClNO4 — CID 102614410
methyl 4-chloro-6,7-dimethoxyquinoline-3-carboxylate (PubChem CID 102614410) has the molecular formula C13H12ClNO4 and a molecular weight of 281.70 g/mol. Its IUPAC name is methyl 4-chloro-6,7-dimethoxyquinoline-3-carboxylate.
| Compound Name | methyl 4-chloro-6,7-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614410 |
| Molecular Formula | C13H12ClNO4 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 4-chloro-6,7-dimethoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cnc2cc(OC)c(OC)cc2c1Cl |
| InChI | InChI=1S/C13H12ClNO4/c1-17-10-4-7-9(5-11(10)18-2)15-6-8(12(7)14)13(16)19-3/h4-6H,1-3H3 |
| InChIKey | GHGWJBKRLFIYOF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |