C7H6Cl2NO2P — CID 178139043
methyl 4,6-dichloro-5-phosphanylpyridine-3-carboxylate (PubChem CID 178139043) has the molecular formula C7H6Cl2NO2P and a molecular weight of 238.01 g/mol. Its IUPAC name is methyl 4,6-dichloro-5-phosphanylpyridine-3-carboxylate.
| Compound Name | methyl 4,6-dichloro-5-phosphanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 178139043 |
| Molecular Formula | C7H6Cl2NO2P |
| Molecular Weight | 238.01 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | methyl 4,6-dichloro-5-phosphanylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Cl)c(P)c1Cl |
| InChI | InChI=1S/C7H6Cl2NO2P/c1-12-7(11)3-2-10-6(9)5(13)4(3)8/h2H,13H2,1H3 |
| InChIKey | CGGKWJGLVCQSRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.01 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|