C9H10ClNO2 — CID 154578056
methyl 4-chloro-5,6-dimethylpyridine-3-carboxylate (PubChem CID 154578056) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is methyl 4-chloro-5,6-dimethylpyridine-3-carboxylate.
| Compound Name | methyl 4-chloro-5,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 154578056 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | methyl 4-chloro-5,6-dimethylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(C)c(C)c1Cl |
| InChI | InChI=1S/C9H10ClNO2/c1-5-6(2)11-4-7(8(5)10)9(12)13-3/h4H,1-3H3 |
| InChIKey | BMRFFRHYNVAOAB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |