C9H9Cl2NO2 — CID 20703477
methyl 4,6-dichloro-2,5-dimethylpyridine-3-carboxylate (PubChem CID 20703477) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is methyl 4,6-dichloro-2,5-dimethylpyridine-3-carboxylate.
| Compound Name | methyl 4,6-dichloro-2,5-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 20703477 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | methyl 4,6-dichloro-2,5-dimethylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(Cl)c(C)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO2/c1-4-7(10)6(9(13)14-3)5(2)12-8(4)11/h1-3H3 |
| InChIKey | CEBTZLUHJHGPTR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|