C10H9ClN2O2 — CID 20703481
methyl 6-chloro-4-cyano-2,5-dimethylpyridine-3-carboxylate (PubChem CID 20703481) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is methyl 6-chloro-4-cyano-2,5-dimethylpyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-4-cyano-2,5-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 20703481 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | methyl 6-chloro-4-cyano-2,5-dimethylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(Cl)c(C)c1C#N |
| InChI | InChI=1S/C10H9ClN2O2/c1-5-7(4-12)8(10(14)15-3)6(2)13-9(5)11/h1-3H3 |
| InChIKey | CAVQJAYULGDDLK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|