C11H11ClN2O2 — CID 84613491
methyl 2-(6-chloro-5-cyano-2,4-dimethyl-3-pyridinyl)acetate (PubChem CID 84613491) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is methyl 2-(6-chloro-5-cyano-2,4-dimethyl-3-pyridinyl)acetate.
| Compound Name | methyl 2-(6-chloro-5-cyano-2,4-dimethyl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 84613491 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | methyl 2-(6-chloro-5-cyano-2,4-dimethyl-3-pyridinyl)acetate |
| SMILES | COC(=O)Cc1c(C)nc(Cl)c(C#N)c1C |
| InChI | InChI=1S/C11H11ClN2O2/c1-6-8(4-10(15)16-3)7(2)14-11(12)9(6)5-13/h4H2,1-3H3 |
| InChIKey | YQQSQIKCVPXOLS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|