C15H13N3O3 — CID 45104903
methyl 4-amino-5-cyano-2-methyl-6-phenoxypyridine-3-carboxylate (PubChem CID 45104903) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is methyl 4-amino-5-cyano-2-methyl-6-phenoxypyridine-3-carboxylate.
| Compound Name | methyl 4-amino-5-cyano-2-methyl-6-phenoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 45104903 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | methyl 4-amino-5-cyano-2-methyl-6-phenoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(Oc2ccccc2)c(C#N)c1N |
| InChI | InChI=1S/C15H13N3O3/c1-9-12(15(19)20-2)13(17)11(8-16)14(18-9)21-10-6-4-3-5-7-10/h3-7H,1-2H3,(H2,17,18) |
| InChIKey | UQQKPLYZAYXLEL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |