C23H21NO5 — CID 19232495
dimethyl 2,6-dimethyl-4-(3-phenoxyphenyl)pyridine-3,5-dicarboxylate (PubChem CID 19232495) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-(3-phenoxyphenyl)pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-(3-phenoxyphenyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19232495 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-(3-phenoxyphenyl)pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OC)c1-c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H21NO5/c1-14-19(22(25)27-3)21(20(15(2)24-14)23(26)28-4)16-9-8-12-18(13-16)29-17-10-6-5-7-11-17/h5-13H,1-4H3 |
| InChIKey | DFCUUOXQLBKCMS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |