C25H21F3N2O7 — CID 13219230
5-O-methyl 3-O-[2-[3-(trifluoromethyl)phenoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (PubChem CID 13219230) has the molecular formula C25H21F3N2O7 and a molecular weight of 518.44 g/mol. Its IUPAC name is 5-O-methyl 3-O-[2-[3-(trifluoromethyl)phenoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-[2-[3-(trifluoromethyl)phenoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13219230 |
| Molecular Formula | C25H21F3N2O7 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 5-O-methyl 3-O-[2-[3-(trifluoromethyl)phenoxy]ethyl] 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OCCOc2cccc(C(F)(F)F)c2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21F3N2O7/c1-14-20(23(31)35-3)22(16-6-4-8-18(12-16)30(33)34)21(15(2)29-14)24(32)37-11-10-36-19-9-5-7-17(13-19)25(26,27)28/h4-9,12-13H,10-11H2,1-3H3 |
| InChIKey | USQWHZSYSGTPAN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 117.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|