C25H32N2O8 — CID 14686765
bis(2-propoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (PubChem CID 14686765) has the molecular formula C25H32N2O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is bis(2-propoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate.
| Compound Name | bis(2-propoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14686765 |
| Molecular Formula | C25H32N2O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | bis(2-propoxyethyl) 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| SMILES | CCCOCCOC(=O)c1c(C)nc(C)c(C(=O)OCCOCCC)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H32N2O8/c1-5-10-32-12-14-34-24(28)21-17(3)26-18(4)22(25(29)35-15-13-33-11-6-2)23(21)19-8-7-9-20(16-19)27(30)31/h7-9,16H,5-6,10-15H2,1-4H3 |
| InChIKey | LRQXIOSXCAXKER-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 127.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|