C25H32N2O8P+ — CID 56616935
[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxy-bis(prop-2-enoxy)phosphanium (PubChem CID 56616935) has the molecular formula C25H32N2O8P+ and a molecular weight of 519.51 g/mol. Its IUPAC name is [2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxy-bis(prop-2-enoxy)phosphanium.
| Compound Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxy-bis(prop-2-enoxy)phosphanium |
|---|---|
| PubChem CID | 56616935 |
| Molecular Formula | C25H32N2O8P+ |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | [2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxy-bis(prop-2-enoxy)phosphanium |
| SMILES | C=CCO[P+](O)(OCC=C)c1c(C)nc(C)c(C(=O)OCCOCCC)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H32N2O8P/c1-6-12-32-15-16-33-25(28)22-18(4)26-19(5)24(36(31,34-13-7-2)35-14-8-3)23(22)20-10-9-11-21(17-20)27(29)30/h7-11,17,31H,2-3,6,12-16H2,1,4-5H3/q+1 |
| InChIKey | KLUJNQWUTPQCFR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|