C27H40N2O8P+ — CID 56635458
dibutoxy-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxyphosphanium (PubChem CID 56635458) has the molecular formula C27H40N2O8P+ and a molecular weight of 551.60 g/mol. Its IUPAC name is dibutoxy-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxyphosphanium.
| Compound Name | dibutoxy-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxyphosphanium |
|---|---|
| PubChem CID | 56635458 |
| Molecular Formula | C27H40N2O8P+ |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | dibutoxy-[2,6-dimethyl-4-(3-nitrophenyl)-5-(2-propoxyethoxycarbonyl)-3-pyridinyl]-hydroxyphosphanium |
| SMILES | CCCCO[P+](O)(OCCCC)c1c(C)nc(C)c(C(=O)OCCOCCC)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H40N2O8P/c1-6-9-15-36-38(33,37-16-10-7-2)26-21(5)28-20(4)24(27(30)35-18-17-34-14-8-3)25(26)22-12-11-13-23(19-22)29(31)32/h11-13,19,33H,6-10,14-18H2,1-5H3/q+1 |
| InChIKey | ATNQLJIJPBRJOJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|