C25H32N2O9P+ — CID 56626213
hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-bis(oxolan-2-ylmethoxy)phosphanium (PubChem CID 56626213) has the molecular formula C25H32N2O9P+ and a molecular weight of 535.51 g/mol. Its IUPAC name is hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-bis(oxolan-2-ylmethoxy)phosphanium.
| Compound Name | hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-bis(oxolan-2-ylmethoxy)phosphanium |
|---|---|
| PubChem CID | 56626213 |
| Molecular Formula | C25H32N2O9P+ |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]-bis(oxolan-2-ylmethoxy)phosphanium |
| SMILES | COC(=O)c1c(C)nc(C)c([P+](O)(OCC2CCCO2)OCC2CCCO2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H32N2O9P/c1-16-22(25(28)32-3)23(18-7-4-8-19(13-18)27(29)30)24(17(2)26-16)37(31,35-14-20-9-5-11-33-20)36-15-21-10-6-12-34-21/h4,7-8,13,20-21,31H,5-6,9-12,14-15H2,1-3H3/q+1 |
| InChIKey | FFHFBKIUEPJIEX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|