C23H28N2O7P+ — CID 56639492
methyl 5-(3-hydroxy-2,4-dioxa-3-phosphoniaspiro[5.5]undecan-3-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate (PubChem CID 56639492) has the molecular formula C23H28N2O7P+ and a molecular weight of 475.46 g/mol. Its IUPAC name is methyl 5-(3-hydroxy-2,4-dioxa-3-phosphoniaspiro[5.5]undecan-3-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(3-hydroxy-2,4-dioxa-3-phosphoniaspiro[5.5]undecan-3-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 56639492 |
| Molecular Formula | C23H28N2O7P+ |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl 5-(3-hydroxy-2,4-dioxa-3-phosphoniaspiro[5.5]undecan-3-yl)-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c([P+]2(O)OCC3(CCCCC3)CO2)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N2O7P/c1-15-19(22(26)30-3)20(17-8-7-9-18(12-17)25(27)28)21(16(2)24-15)33(29)31-13-23(14-32-33)10-5-4-6-11-23/h7-9,12,29H,4-6,10-11,13-14H2,1-3H3/q+1 |
| InChIKey | YOKISBIOKWHLEN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|