C22H24ClN3O9 — CID 160585410
5-[1-(2-chloroethyl)cyclopentyl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid;nitric acid (PubChem CID 160585410) has the molecular formula C22H24ClN3O9 and a molecular weight of 509.90 g/mol. Its IUPAC name is 5-[1-(2-chloroethyl)cyclopentyl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid;nitric acid.
| Compound Name | 5-[1-(2-chloroethyl)cyclopentyl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid;nitric acid |
|---|---|
| PubChem CID | 160585410 |
| Molecular Formula | C22H24ClN3O9 |
| Molecular Weight | 509.90 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 5-[1-(2-chloroethyl)cyclopentyl]oxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)pyridine-3-carboxylic acid;nitric acid |
| SMILES | Cc1nc(C)c(C(=O)OC2(CCCl)CCCC2)c(-c2cccc([N+](=O)[O-])c2)c1C(=O)O.O=[N+]([O-])O |
| InChI | InChI=1S/C22H23ClN2O6.HNO3/c1-13-17(20(26)27)19(15-6-5-7-16(12-15)25(29)30)18(14(2)24-13)21(28)31-22(10-11-23)8-3-4-9-22;2-1(3)4/h5-7,12H,3-4,8-11H2,1-2H3,(H,26,27);(H,2,3,4) |
| InChIKey | HHIGLQMHDQTDHG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 183.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|