C27H40N2O7P+ — CID 56624238
di(hexan-3-yloxy)-hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]phosphanium (PubChem CID 56624238) has the molecular formula C27H40N2O7P+ and a molecular weight of 535.60 g/mol. Its IUPAC name is di(hexan-3-yloxy)-hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]phosphanium.
| Compound Name | di(hexan-3-yloxy)-hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]phosphanium |
|---|---|
| PubChem CID | 56624238 |
| Molecular Formula | C27H40N2O7P+ |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | di(hexan-3-yloxy)-hydroxy-[5-methoxycarbonyl-2,6-dimethyl-4-(3-nitrophenyl)-3-pyridinyl]phosphanium |
| SMILES | CCCC(CC)O[P+](O)(OC(CC)CCC)c1c(C)nc(C)c(C(=O)OC)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H40N2O7P/c1-8-13-22(10-3)35-37(33,36-23(11-4)14-9-2)26-19(6)28-18(5)24(27(30)34-7)25(26)20-15-12-16-21(17-20)29(31)32/h12,15-17,22-23,33H,8-11,13-14H2,1-7H3/q+1 |
| InChIKey | MWBADZWHWQHWJN-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|