C14H14N2O2 — CID 141175511
2,4,6-trimethyl-3-(3-nitrophenyl)pyridine (PubChem CID 141175511) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-(3-nitrophenyl)pyridine.
| Compound Name | 2,4,6-trimethyl-3-(3-nitrophenyl)pyridine |
|---|---|
| PubChem CID | 141175511 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2,4,6-trimethyl-3-(3-nitrophenyl)pyridine |
| SMILES | Cc1cc(C)c(-c2cccc([N+](=O)[O-])c2)c(C)n1 |
| InChI | InChI=1S/C14H14N2O2/c1-9-7-10(2)15-11(3)14(9)12-5-4-6-13(8-12)16(17)18/h4-8H,1-3H3 |
| InChIKey | AIPXAZJHHGWDGY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|