C14H12ClNO3 — CID 91006237
4-chloro-2,5-dimethyl-3-(3-nitrophenyl)phenol (PubChem CID 91006237) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is 4-chloro-2,5-dimethyl-3-(3-nitrophenyl)phenol.
| Compound Name | 4-chloro-2,5-dimethyl-3-(3-nitrophenyl)phenol |
|---|---|
| PubChem CID | 91006237 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4-chloro-2,5-dimethyl-3-(3-nitrophenyl)phenol |
| SMILES | Cc1cc(O)c(C)c(-c2cccc([N+](=O)[O-])c2)c1Cl |
| InChI | InChI=1S/C14H12ClNO3/c1-8-6-12(17)9(2)13(14(8)15)10-4-3-5-11(7-10)16(18)19/h3-7,17H,1-2H3 |
| InChIKey | TYWSWFKHVAUVEE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|