About nitric acid;4-(3-nitrophenyl)pyridine
nitric acid;4-(3-nitrophenyl)pyridine (PubChem CID 71334650) has the molecular formula C11H9N3O5
and a molecular weight of 263.21 g/mol. Its IUPAC name is nitric acid;4-(3-nitrophenyl)pyridine.
Molecular Properties
| Compound Name | nitric acid;4-(3-nitrophenyl)pyridine |
| PubChem CID | 71334650 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | nitric acid;4-(3-nitrophenyl)pyridine |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])c1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C11H8N2O2.HNO3/c14-13(15)11-3-1-2-10(8-11)9-4-6-12-7-5-9;2-1(3)4/h1-8H;(H,2,3,4) |
| InChIKey | ZSVUKVZNLBFVJS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;4-(3-nitrophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;4-(3-nitrophenyl)pyridine?
The IUPAC name of nitric acid;4-(3-nitrophenyl)pyridine (CID 71334650) is nitric acid;4-(3-nitrophenyl)pyridine.
What is the SMILES notation for nitric acid;4-(3-nitrophenyl)pyridine?
The canonical SMILES for nitric acid;4-(3-nitrophenyl)pyridine is O=[N+]([O-])O.O=[N+]([O-])c1cccc(-c2ccncc2)c1.
What is the InChIKey of nitric acid;4-(3-nitrophenyl)pyridine?
The InChIKey is ZSVUKVZNLBFVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2.HNO3/c14-13(15)11-3-1-2-10(8-11)9-4-6-12-7-5-9;2-1(3)4/h1-8H;(H,2,3,4).
What are the key properties of nitric acid;4-(3-nitrophenyl)pyridine?
nitric acid;4-(3-nitrophenyl)pyridine has a molecular weight of 263.21 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;4-(3-nitrophenyl)pyridine is sourced from PubChem (CID 71334650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).