About 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine
1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine (PubChem CID 139939427) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine |
| PubChem CID | 139939427 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine |
| SMILES | COC(C)OC.O=[N+]([O-])c1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C11H8N2O2.C4H10O2/c14-13(15)11-3-1-2-10(8-11)9-4-6-12-7-5-9;1-4(5-2)6-3/h1-8H;4H,1-3H3 |
| InChIKey | NCKRZQNIHWEIRW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine?
The IUPAC name of 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine (CID 139939427) is 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine.
What is the SMILES notation for 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine?
The canonical SMILES for 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine is COC(C)OC.O=[N+]([O-])c1cccc(-c2ccncc2)c1.
What is the InChIKey of 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine?
The InChIKey is NCKRZQNIHWEIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2.C4H10O2/c14-13(15)11-3-1-2-10(8-11)9-4-6-12-7-5-9;1-4(5-2)6-3/h1-8H;4H,1-3H3.
What are the key properties of 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine?
1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine has a molecular weight of 290.32 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;4-(3-nitrophenyl)pyridine is sourced from PubChem (CID 139939427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).