C18H14N2O4 — CID 174540087
1,1'-biphenyl;1,3-dinitrobenzene (PubChem CID 174540087) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 1,1'-biphenyl;1,3-dinitrobenzene.
| Compound Name | 1,1'-biphenyl;1,3-dinitrobenzene |
|---|---|
| PubChem CID | 174540087 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1,1'-biphenyl;1,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C6H4N2O4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-10H;1-4H |
| InChIKey | QMEOFQZOWKQGJE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|