About formic acid;1-nitro-3-phenylbenzene
formic acid;1-nitro-3-phenylbenzene (PubChem CID 158057338) has the molecular formula C13H11NO4
and a molecular weight of 245.23 g/mol. Its IUPAC name is formic acid;1-nitro-3-phenylbenzene.
Molecular Properties
| Compound Name | formic acid;1-nitro-3-phenylbenzene |
| PubChem CID | 158057338 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | formic acid;1-nitro-3-phenylbenzene |
| SMILES | O=CO.O=[N+]([O-])c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H9NO2.CH2O2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;2-1-3/h1-9H;1H,(H,2,3) |
| InChIKey | FKFHPKCQYPVPMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-nitro-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-nitro-3-phenylbenzene?
The IUPAC name of formic acid;1-nitro-3-phenylbenzene (CID 158057338) is formic acid;1-nitro-3-phenylbenzene.
What is the SMILES notation for formic acid;1-nitro-3-phenylbenzene?
The canonical SMILES for formic acid;1-nitro-3-phenylbenzene is O=CO.O=[N+]([O-])c1cccc(-c2ccccc2)c1.
What is the InChIKey of formic acid;1-nitro-3-phenylbenzene?
The InChIKey is FKFHPKCQYPVPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2.CH2O2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10;2-1-3/h1-9H;1H,(H,2,3).
What are the key properties of formic acid;1-nitro-3-phenylbenzene?
formic acid;1-nitro-3-phenylbenzene has a molecular weight of 245.23 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-nitro-3-phenylbenzene is sourced from PubChem (CID 158057338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).