About 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole
5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole (PubChem CID 102369150) has the molecular formula C22H16N2O2
and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole.
Molecular Properties
| Compound Name | 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole |
| PubChem CID | 102369150 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole |
| SMILES | O=[N+]([O-])c1cccc(-c2cc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C22H16N2O2/c25-24(26)19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)22(23-21)17-10-5-2-6-11-17/h1-15,23H |
| InChIKey | HXUUWOXNWUMJRE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole?
The IUPAC name of 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole (CID 102369150) is 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole.
What is the SMILES notation for 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole?
The canonical SMILES for 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole is O=[N+]([O-])c1cccc(-c2cc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1.
What is the InChIKey of 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole?
The InChIKey is HXUUWOXNWUMJRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O2/c25-24(26)19-13-7-12-18(14-19)21-15-20(16-8-3-1-4-9-16)22(23-21)17-10-5-2-6-11-17/h1-15,23H.
What are the key properties of 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole?
5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole has a molecular weight of 340.38 g/mol, XLogP of 5.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-nitrophenyl)-2,3-diphenyl-1H-pyrrole is sourced from PubChem (CID 102369150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).