C17H17AsN2O8 — CID 150521733
[2-acetamido-5-acetyl-3-hydroxy-4-methyl-6-(3-nitrophenyl)phenyl]arsonic acid (PubChem CID 150521733) has the molecular formula C17H17AsN2O8 and a molecular weight of 452.25 g/mol. Its IUPAC name is [2-acetamido-5-acetyl-3-hydroxy-4-methyl-6-(3-nitrophenyl)phenyl]arsonic acid.
| Compound Name | [2-acetamido-5-acetyl-3-hydroxy-4-methyl-6-(3-nitrophenyl)phenyl]arsonic acid |
|---|---|
| PubChem CID | 150521733 |
| Molecular Formula | C17H17AsN2O8 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [2-acetamido-5-acetyl-3-hydroxy-4-methyl-6-(3-nitrophenyl)phenyl]arsonic acid |
| SMILES | CC(=O)Nc1c(O)c(C)c(C(C)=O)c(-c2cccc([N+](=O)[O-])c2)c1[As](=O)(O)O |
| InChI | InChI=1S/C17H17AsN2O8/c1-8-13(9(2)21)14(11-5-4-6-12(7-11)20(27)28)15(18(24,25)26)16(17(8)23)19-10(3)22/h4-7,23H,1-3H3,(H,19,22)(H2,24,25,26) |
| InChIKey | IBZLEEGOAIIQNA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 167.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|