C22H24N2O10 — CID 70471352
2-[[2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-3-pyridinyl]oxycarbonyloxy]ethyl acetate (PubChem CID 70471352) has the molecular formula C22H24N2O10 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-3-pyridinyl]oxycarbonyloxy]ethyl acetate.
| Compound Name | 2-[[2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-3-pyridinyl]oxycarbonyloxy]ethyl acetate |
|---|---|
| PubChem CID | 70471352 |
| Molecular Formula | C22H24N2O10 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[[2,6-dimethyl-4-(3-nitrophenyl)-5-propan-2-yloxycarbonyloxy-3-pyridinyl]oxycarbonyloxy]ethyl acetate |
| SMILES | CC(=O)OCCOC(=O)Oc1c(C)nc(C)c(OC(=O)OC(C)C)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N2O10/c1-12(2)32-22(27)34-20-14(4)23-13(3)19(33-21(26)31-10-9-30-15(5)25)18(20)16-7-6-8-17(11-16)24(28)29/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | FHIHRYUVDKFQTR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 153.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|