C20H20N2O8 — CID 91748590
5-O-(2-methoxy-2-oxoethyl) 3-O-propan-2-yl 2-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (PubChem CID 91748590) has the molecular formula C20H20N2O8 and a molecular weight of 416.39 g/mol. Its IUPAC name is 5-O-(2-methoxy-2-oxoethyl) 3-O-propan-2-yl 2-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-methoxy-2-oxoethyl) 3-O-propan-2-yl 2-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91748590 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 5-O-(2-methoxy-2-oxoethyl) 3-O-propan-2-yl 2-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)COC(=O)c1cnc(C)c(C(=O)OC(C)C)c1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20N2O8/c1-11(2)30-20(25)17-12(3)21-9-15(19(24)29-10-16(23)28-4)18(17)13-6-5-7-14(8-13)22(26)27/h5-9,11H,10H2,1-4H3 |
| InChIKey | OUNDLGCXBQDMKZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 134.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|