C24H24N2O8 — CID 101187120
2-O,8-O-dimethyl 6-O-propan-2-yl 3,5-dimethyl-7-(3-nitrophenyl)indolizine-2,6,8-tricarboxylate (PubChem CID 101187120) has the molecular formula C24H24N2O8 and a molecular weight of 468.46 g/mol. Its IUPAC name is 2-O,8-O-dimethyl 6-O-propan-2-yl 3,5-dimethyl-7-(3-nitrophenyl)indolizine-2,6,8-tricarboxylate.
| Compound Name | 2-O,8-O-dimethyl 6-O-propan-2-yl 3,5-dimethyl-7-(3-nitrophenyl)indolizine-2,6,8-tricarboxylate |
|---|---|
| PubChem CID | 101187120 |
| Molecular Formula | C24H24N2O8 |
| Molecular Weight | 468.46 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-O,8-O-dimethyl 6-O-propan-2-yl 3,5-dimethyl-7-(3-nitrophenyl)indolizine-2,6,8-tricarboxylate |
| SMILES | COC(=O)c1cc2c(C(=O)OC)c(-c3cccc([N+](=O)[O-])c3)c(C(=O)OC(C)C)c(C)n2c1C |
| InChI | InChI=1S/C24H24N2O8/c1-12(2)34-24(29)19-14(4)25-13(3)17(22(27)32-5)11-18(25)21(23(28)33-6)20(19)15-8-7-9-16(10-15)26(30)31/h7-12H,1-6H3 |
| InChIKey | AFCIBUUBVFRJBB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 126.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|